C41H70N5O9P — CID 176768811
[(2R,4S,5R)-5-(4-aminopyrrolo[2,1-f][1,2,4]triazin-7-yl)-5-cyano-3,4-dihydroxyoxolan-2-yl]methyl [(2R)-2-(2-cyclohexylethoxy)-12-nonoxydodecyl] hydrogen phosphate (PubChem CID 176768811) has the molecular formula C41H70N5O9P and a molecular weight of 808.01 g/mol. Its IUPAC name is [(2R,4S,5R)-5-(4-aminopyrrolo[2,1-f][1,2,4]triazin-7-yl)-5-cyano-3,4-dihydroxyoxolan-2-yl]methyl [(2R)-2-(2-cyclohexylethoxy)-12-nonoxydodecyl] hydrogen phosphate.
| Compound Name | [(2R,4S,5R)-5-(4-aminopyrrolo[2,1-f][1,2,4]triazin-7-yl)-5-cyano-3,4-dihydroxyoxolan-2-yl]methyl [(2R)-2-(2-cyclohexylethoxy)-12-nonoxydodecyl] hydrogen phosphate |
|---|---|
| PubChem CID | 176768811 |
| Molecular Formula | C41H70N5O9P |
| Molecular Weight | 808.01 g/mol |
| Exact Mass | 807.49 |
| IUPAC Name | [(2R,4S,5R)-5-(4-aminopyrrolo[2,1-f][1,2,4]triazin-7-yl)-5-cyano-3,4-dihydroxyoxolan-2-yl]methyl [(2R)-2-(2-cyclohexylethoxy)-12-nonoxydodecyl] hydrogen phosphate |
| SMILES | CCCCCCCCCOCCCCCCCCCC[C@H](COP(=O)(O)OC[C@H]1O[C@@](C#N)(c2ccc3c(N)ncnn23)[C@@H](O)C1O)OCCC1CCCCC1 |
| InChI | InChI=1S/C41H70N5O9P/c1-2-3-4-5-9-12-18-26-51-27-19-13-10-7-6-8-11-17-22-34(52-28-25-33-20-15-14-16-21-33)29-53-56(49,50)54-30-36-38(47)39(48)41(31-42,55-36)37-24-23-35-40(43)44-32-45-46(35)37/h23-24,32-34,36,38-39,47-48H,2-22,25-30H2,1H3,(H,49,50)(H2,43,44,45)/t34-,36-,38?,39+,41+/m1/s1 |
| InChIKey | JPXRCPMYKFQSLP-ONCYDPDLSA-N |
| XLogP | 7.92 |
| TPSA | 203.91 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 30 |
| Heavy Atoms | 56 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 808.01 |
| LogP ≤ 5 | 7.92 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|