C23H35N4O8P — CID 165001981
[(2R,3S,4R,5R)-5-cyano-3,4-dihydroxy-5-(4-methylpyrrolo[2,1-f][1,2,4]triazin-7-yl)oxolan-2-yl]methyl 2-octoxyethyl hydrogen phosphate (PubChem CID 165001981) has the molecular formula C23H35N4O8P and a molecular weight of 526.53 g/mol. Its IUPAC name is [(2R,3S,4R,5R)-5-cyano-3,4-dihydroxy-5-(4-methylpyrrolo[2,1-f][1,2,4]triazin-7-yl)oxolan-2-yl]methyl 2-octoxyethyl hydrogen phosphate.
| Compound Name | [(2R,3S,4R,5R)-5-cyano-3,4-dihydroxy-5-(4-methylpyrrolo[2,1-f][1,2,4]triazin-7-yl)oxolan-2-yl]methyl 2-octoxyethyl hydrogen phosphate |
|---|---|
| PubChem CID | 165001981 |
| Molecular Formula | C23H35N4O8P |
| Molecular Weight | 526.53 g/mol |
| Exact Mass | 526.22 |
| IUPAC Name | [(2R,3S,4R,5R)-5-cyano-3,4-dihydroxy-5-(4-methylpyrrolo[2,1-f][1,2,4]triazin-7-yl)oxolan-2-yl]methyl 2-octoxyethyl hydrogen phosphate |
| SMILES | CCCCCCCCOCCOP(=O)(O)OC[C@H]1O[C@@](C#N)(c2ccc3c(C)ncnn23)[C@H](O)[C@@H]1O |
| InChI | InChI=1S/C23H35N4O8P/c1-3-4-5-6-7-8-11-32-12-13-33-36(30,31)34-14-19-21(28)22(29)23(15-24,35-19)20-10-9-18-17(2)25-16-26-27(18)20/h9-10,16,19,21-22,28-29H,3-8,11-14H2,1-2H3,(H,30,31)/t19-,21-,22-,23+/m1/s1 |
| InChIKey | URHOQZIVPFCWHQ-ADHNFCLRSA-N |
| XLogP | 2.39 |
| TPSA | 168.66 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 526.53 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|