C25H32N6O9 — CID 170055046
[(2R,3S,4R,5R)-5-cyano-4-hydroxy-3-propanoyloxy-5-[4-(prop-1-en-2-yloxymethoxycarbonylamino)pyrrolo[2,1-f][1,2,4]triazin-7-yl]oxolan-2-yl]methyl (2S)-2-amino-3-methylbutanoate (PubChem CID 170055046) has the molecular formula C25H32N6O9 and a molecular weight of 560.56 g/mol. Its IUPAC name is [(2R,3S,4R,5R)-5-cyano-4-hydroxy-3-propanoyloxy-5-[4-(prop-1-en-2-yloxymethoxycarbonylamino)pyrrolo[2,1-f][1,2,4]triazin-7-yl]oxolan-2-yl]methyl (2S)-2-amino-3-methylbutanoate.
| Compound Name | [(2R,3S,4R,5R)-5-cyano-4-hydroxy-3-propanoyloxy-5-[4-(prop-1-en-2-yloxymethoxycarbonylamino)pyrrolo[2,1-f][1,2,4]triazin-7-yl]oxolan-2-yl]methyl (2S)-2-amino-3-methylbutanoate |
|---|---|
| PubChem CID | 170055046 |
| Molecular Formula | C25H32N6O9 |
| Molecular Weight | 560.56 g/mol |
| Exact Mass | 560.22 |
| IUPAC Name | [(2R,3S,4R,5R)-5-cyano-4-hydroxy-3-propanoyloxy-5-[4-(prop-1-en-2-yloxymethoxycarbonylamino)pyrrolo[2,1-f][1,2,4]triazin-7-yl]oxolan-2-yl]methyl (2S)-2-amino-3-methylbutanoate |
| SMILES | C=C(C)OCOC(=O)Nc1ncnn2c([C@]3(C#N)O[C@H](COC(=O)[C@@H](N)C(C)C)[C@@H](OC(=O)CC)[C@H]3O)ccc12 |
| InChI | InChI=1S/C25H32N6O9/c1-6-18(32)39-20-16(9-36-23(34)19(27)13(2)3)40-25(10-26,21(20)33)17-8-7-15-22(28-11-29-31(15)17)30-24(35)38-12-37-14(4)5/h7-8,11,13,16,19-21,33H,4,6,9,12,27H2,1-3,5H3,(H,28,29,30,35)/t16-,19+,20-,21-,25+/m1/s1 |
| InChIKey | NWELTOOJARYSMG-WEAVEQPUSA-N |
| XLogP | 1.11 |
| TPSA | 209.62 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 560.56 |
| LogP ≤ 5 | 1.11 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|