C22H26N6O10 — CID 170057559
[(2R,3S,4R,5R)-3-(acetyloxymethoxycarbonyloxy)-5-cyano-4-hydroxy-5-[4-(2-methylpropanoylamino)pyrrolo[2,1-f][1,2,4]triazin-7-yl]oxolan-2-yl]methyl 2-aminoacetate (PubChem CID 170057559) has the molecular formula C22H26N6O10 and a molecular weight of 534.48 g/mol. Its IUPAC name is [(2R,3S,4R,5R)-3-(acetyloxymethoxycarbonyloxy)-5-cyano-4-hydroxy-5-[4-(2-methylpropanoylamino)pyrrolo[2,1-f][1,2,4]triazin-7-yl]oxolan-2-yl]methyl 2-aminoacetate.
| Compound Name | [(2R,3S,4R,5R)-3-(acetyloxymethoxycarbonyloxy)-5-cyano-4-hydroxy-5-[4-(2-methylpropanoylamino)pyrrolo[2,1-f][1,2,4]triazin-7-yl]oxolan-2-yl]methyl 2-aminoacetate |
|---|---|
| PubChem CID | 170057559 |
| Molecular Formula | C22H26N6O10 |
| Molecular Weight | 534.48 g/mol |
| Exact Mass | 534.17 |
| IUPAC Name | [(2R,3S,4R,5R)-3-(acetyloxymethoxycarbonyloxy)-5-cyano-4-hydroxy-5-[4-(2-methylpropanoylamino)pyrrolo[2,1-f][1,2,4]triazin-7-yl]oxolan-2-yl]methyl 2-aminoacetate |
| SMILES | CC(=O)OCOC(=O)O[C@H]1[C@@H](O)[C@](C#N)(c2ccc3c(NC(=O)C(C)C)ncnn23)O[C@@H]1COC(=O)CN |
| InChI | InChI=1S/C22H26N6O10/c1-11(2)20(32)27-19-13-4-5-15(28(13)26-9-25-19)22(8-24)18(31)17(14(38-22)7-34-16(30)6-23)37-21(33)36-10-35-12(3)29/h4-5,9,11,14,17-18,31H,6-7,10,23H2,1-3H3,(H,25,26,27,32)/t14-,17-,18-,22+/m1/s1 |
| InChIKey | QPWMJRLAKUETBF-YEZBQYDXSA-N |
| XLogP | -0.65 |
| TPSA | 226.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 15 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 534.48 |
| LogP ≤ 5 | -0.65 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 15 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|