C26H28N6O9 — CID 170055047
[(2R,3S,4R,5R)-5-[4-[[(2S)-2-amino-3-(4-methylphenyl)propanoyl]amino]pyrrolo[2,1-f][1,2,4]triazin-7-yl]-5-cyano-3,4-dihydroxyoxolan-2-yl]methoxycarbonyloxymethyl acetate (PubChem CID 170055047) has the molecular formula C26H28N6O9 and a molecular weight of 568.54 g/mol. Its IUPAC name is [(2R,3S,4R,5R)-5-[4-[[(2S)-2-amino-3-(4-methylphenyl)propanoyl]amino]pyrrolo[2,1-f][1,2,4]triazin-7-yl]-5-cyano-3,4-dihydroxyoxolan-2-yl]methoxycarbonyloxymethyl acetate.
| Compound Name | [(2R,3S,4R,5R)-5-[4-[[(2S)-2-amino-3-(4-methylphenyl)propanoyl]amino]pyrrolo[2,1-f][1,2,4]triazin-7-yl]-5-cyano-3,4-dihydroxyoxolan-2-yl]methoxycarbonyloxymethyl acetate |
|---|---|
| PubChem CID | 170055047 |
| Molecular Formula | C26H28N6O9 |
| Molecular Weight | 568.54 g/mol |
| Exact Mass | 568.19 |
| IUPAC Name | [(2R,3S,4R,5R)-5-[4-[[(2S)-2-amino-3-(4-methylphenyl)propanoyl]amino]pyrrolo[2,1-f][1,2,4]triazin-7-yl]-5-cyano-3,4-dihydroxyoxolan-2-yl]methoxycarbonyloxymethyl acetate |
| SMILES | CC(=O)OCOC(=O)OC[C@H]1O[C@@](C#N)(c2ccc3c(NC(=O)[C@@H](N)Cc4ccc(C)cc4)ncnn23)[C@H](O)[C@@H]1O |
| InChI | InChI=1S/C26H28N6O9/c1-14-3-5-16(6-4-14)9-17(28)24(36)31-23-18-7-8-20(32(18)30-12-29-23)26(11-27)22(35)21(34)19(41-26)10-38-25(37)40-13-39-15(2)33/h3-8,12,17,19,21-22,34-35H,9-10,13,28H2,1-2H3,(H,29,30,31,36)/t17-,19+,21+,22+,26-/m0/s1 |
| InChIKey | VICARTQPXWGVPS-XLPFSFBFSA-N |
| XLogP | 0.06 |
| TPSA | 220.62 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 568.54 |
| LogP ≤ 5 | 0.06 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|