C21H30N6O9 — CID 170064763
[(2R,3S,4R,5S)-5-amino-5-[4-[[(2S)-2-amino-3,3-dimethylbutanoyl]amino]pyrrolo[2,1-f][1,2,4]triazin-7-yl]-3,4-dihydroxyoxolan-2-yl]methoxycarbonyloxymethyl acetate (PubChem CID 170064763) has the molecular formula C21H30N6O9 and a molecular weight of 510.50 g/mol. Its IUPAC name is [(2R,3S,4R,5S)-5-amino-5-[4-[[(2S)-2-amino-3,3-dimethylbutanoyl]amino]pyrrolo[2,1-f][1,2,4]triazin-7-yl]-3,4-dihydroxyoxolan-2-yl]methoxycarbonyloxymethyl acetate.
| Compound Name | [(2R,3S,4R,5S)-5-amino-5-[4-[[(2S)-2-amino-3,3-dimethylbutanoyl]amino]pyrrolo[2,1-f][1,2,4]triazin-7-yl]-3,4-dihydroxyoxolan-2-yl]methoxycarbonyloxymethyl acetate |
|---|---|
| PubChem CID | 170064763 |
| Molecular Formula | C21H30N6O9 |
| Molecular Weight | 510.50 g/mol |
| Exact Mass | 510.21 |
| IUPAC Name | [(2R,3S,4R,5S)-5-amino-5-[4-[[(2S)-2-amino-3,3-dimethylbutanoyl]amino]pyrrolo[2,1-f][1,2,4]triazin-7-yl]-3,4-dihydroxyoxolan-2-yl]methoxycarbonyloxymethyl acetate |
| SMILES | CC(=O)OCOC(=O)OC[C@H]1O[C@@](N)(c2ccc3c(NC(=O)[C@@H](N)C(C)(C)C)ncnn23)[C@H](O)[C@@H]1O |
| InChI | InChI=1S/C21H30N6O9/c1-10(28)34-9-35-19(32)33-7-12-14(29)16(30)21(23,36-12)13-6-5-11-17(24-8-25-27(11)13)26-18(31)15(22)20(2,3)4/h5-6,8,12,14-16,29-30H,7,9,22-23H2,1-4H3,(H,24,25,26,31)/t12-,14-,15-,16-,21+/m1/s1 |
| InChIKey | UBOSZOLKSRCJKY-PACZODMPSA-N |
| XLogP | -1.05 |
| TPSA | 222.85 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 510.50 |
| LogP ≤ 5 | -1.05 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|