C28H40N4O9 — CID 170197119
[(2R,3R,4R,5S)-5-methyl-5-[4-(2-methylpropanoylamino)pyrrolo[2,1-f][1,2,4]triazin-7-yl]-4-(2-methylpropanoyloxy)-2-(propan-2-yloxycarbonyloxymethyl)oxolan-3-yl] 2-methylpropanoate (PubChem CID 170197119) has the molecular formula C28H40N4O9 and a molecular weight of 576.65 g/mol. Its IUPAC name is [(2R,3R,4R,5S)-5-methyl-5-[4-(2-methylpropanoylamino)pyrrolo[2,1-f][1,2,4]triazin-7-yl]-4-(2-methylpropanoyloxy)-2-(propan-2-yloxycarbonyloxymethyl)oxolan-3-yl] 2-methylpropanoate.
| Compound Name | [(2R,3R,4R,5S)-5-methyl-5-[4-(2-methylpropanoylamino)pyrrolo[2,1-f][1,2,4]triazin-7-yl]-4-(2-methylpropanoyloxy)-2-(propan-2-yloxycarbonyloxymethyl)oxolan-3-yl] 2-methylpropanoate |
|---|---|
| PubChem CID | 170197119 |
| Molecular Formula | C28H40N4O9 |
| Molecular Weight | 576.65 g/mol |
| Exact Mass | 576.28 |
| IUPAC Name | [(2R,3R,4R,5S)-5-methyl-5-[4-(2-methylpropanoylamino)pyrrolo[2,1-f][1,2,4]triazin-7-yl]-4-(2-methylpropanoyloxy)-2-(propan-2-yloxycarbonyloxymethyl)oxolan-3-yl] 2-methylpropanoate |
| SMILES | CC(C)OC(=O)OC[C@H]1O[C@@](C)(c2ccc3c(NC(=O)C(C)C)ncnn23)[C@H](OC(=O)C(C)C)[C@@H]1OC(=O)C(C)C |
| InChI | InChI=1S/C28H40N4O9/c1-14(2)24(33)31-23-18-10-11-20(32(18)30-13-29-23)28(9)22(40-26(35)16(5)6)21(39-25(34)15(3)4)19(41-28)12-37-27(36)38-17(7)8/h10-11,13-17,19,21-22H,12H2,1-9H3,(H,29,30,31,33)/t19-,21-,22-,28+/m1/s1 |
| InChIKey | HSVUVKCPYFZHFF-PRAAUKRBSA-N |
| XLogP | 3.63 |
| TPSA | 156.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 576.65 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|