C27H31FN6O7 — CID 166530735
[(2R,3S,4R,5R)-5-[4-[[(2S)-2-amino-3-(4-fluorophenyl)propanoyl]amino]pyrrolo[2,1-f][1,2,4]triazin-7-yl]-5-cyano-4-hydroxy-2-(hydroxymethyl)oxolan-3-yl]oxymethyl 2,2-dimethylpropanoate (PubChem CID 166530735) has the molecular formula C27H31FN6O7 and a molecular weight of 570.58 g/mol. Its IUPAC name is [(2R,3S,4R,5R)-5-[4-[[(2S)-2-amino-3-(4-fluorophenyl)propanoyl]amino]pyrrolo[2,1-f][1,2,4]triazin-7-yl]-5-cyano-4-hydroxy-2-(hydroxymethyl)oxolan-3-yl]oxymethyl 2,2-dimethylpropanoate.
| Compound Name | [(2R,3S,4R,5R)-5-[4-[[(2S)-2-amino-3-(4-fluorophenyl)propanoyl]amino]pyrrolo[2,1-f][1,2,4]triazin-7-yl]-5-cyano-4-hydroxy-2-(hydroxymethyl)oxolan-3-yl]oxymethyl 2,2-dimethylpropanoate |
|---|---|
| PubChem CID | 166530735 |
| Molecular Formula | C27H31FN6O7 |
| Molecular Weight | 570.58 g/mol |
| Exact Mass | 570.22 |
| IUPAC Name | [(2R,3S,4R,5R)-5-[4-[[(2S)-2-amino-3-(4-fluorophenyl)propanoyl]amino]pyrrolo[2,1-f][1,2,4]triazin-7-yl]-5-cyano-4-hydroxy-2-(hydroxymethyl)oxolan-3-yl]oxymethyl 2,2-dimethylpropanoate |
| SMILES | CC(C)(C)C(=O)OCO[C@H]1[C@@H](O)[C@](C#N)(c2ccc3c(NC(=O)[C@@H](N)Cc4ccc(F)cc4)ncnn23)O[C@@H]1CO |
| InChI | InChI=1S/C27H31FN6O7/c1-26(2,3)25(38)40-14-39-21-19(11-35)41-27(12-29,22(21)36)20-9-8-18-23(31-13-32-34(18)20)33-24(37)17(30)10-15-4-6-16(28)7-5-15/h4-9,13,17,19,21-22,35-36H,10-11,14,30H2,1-3H3,(H,31,32,33,37)/t17-,19+,21+,22+,27-/m0/s1 |
| InChIKey | OBLYBZPCWMXRES-RRNRPQGBSA-N |
| XLogP | 0.78 |
| TPSA | 194.32 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 570.58 |
| LogP ≤ 5 | 0.78 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|