C23H30N6O5S — CID 177102123
[(3aR,4R,6R,6aR)-4-cyano-4-[4-(dimethylaminomethylideneamino)pyrrolo[2,1-f][1,2,4]triazin-7-yl]-2,2-dimethyl-6,6a-dihydro-3aH-furo[3,4-d][1,3]dioxol-6-yl]methyl tert-butylsulfanylformate (PubChem CID 177102123) has the molecular formula C23H30N6O5S and a molecular weight of 502.60 g/mol. Its IUPAC name is [(3aR,4R,6R,6aR)-4-cyano-4-[4-(dimethylaminomethylideneamino)pyrrolo[2,1-f][1,2,4]triazin-7-yl]-2,2-dimethyl-6,6a-dihydro-3aH-furo[3,4-d][1,3]dioxol-6-yl]methyl tert-butylsulfanylformate.
| Compound Name | [(3aR,4R,6R,6aR)-4-cyano-4-[4-(dimethylaminomethylideneamino)pyrrolo[2,1-f][1,2,4]triazin-7-yl]-2,2-dimethyl-6,6a-dihydro-3aH-furo[3,4-d][1,3]dioxol-6-yl]methyl tert-butylsulfanylformate |
|---|---|
| PubChem CID | 177102123 |
| Molecular Formula | C23H30N6O5S |
| Molecular Weight | 502.60 g/mol |
| Exact Mass | 502.20 |
| IUPAC Name | [(3aR,4R,6R,6aR)-4-cyano-4-[4-(dimethylaminomethylideneamino)pyrrolo[2,1-f][1,2,4]triazin-7-yl]-2,2-dimethyl-6,6a-dihydro-3aH-furo[3,4-d][1,3]dioxol-6-yl]methyl tert-butylsulfanylformate |
| SMILES | CN(C)/C=N/c1ncnn2c([C@]3(C#N)O[C@H](COC(=O)SC(C)(C)C)[C@H]4OC(C)(C)O[C@H]43)ccc12 |
| InChI | InChI=1S/C23H30N6O5S/c1-21(2,3)35-20(30)31-10-15-17-18(34-22(4,5)33-17)23(11-24,32-15)16-9-8-14-19(26-13-28(6)7)25-12-27-29(14)16/h8-9,12-13,15,17-18H,10H2,1-7H3/b26-13+/t15-,17-,18-,23+/m1/s1 |
| InChIKey | OVBJPQLQQASLQF-KJYNOPHUSA-N |
| XLogP | 3.26 |
| TPSA | 123.57 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.60 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|