C18H24N4O6 — CID 169174127
[(3aR,4S,6R,6aR)-4-(4-aminopyrrolo[2,1-f][1,2,4]triazin-7-yl)-2-methoxy-4-methyl-6,6a-dihydro-3aH-furo[3,4-d][1,3]dioxol-6-yl]methyl 2-methylpropanoate (PubChem CID 169174127) has the molecular formula C18H24N4O6 and a molecular weight of 392.41 g/mol. Its IUPAC name is [(3aR,4S,6R,6aR)-4-(4-aminopyrrolo[2,1-f][1,2,4]triazin-7-yl)-2-methoxy-4-methyl-6,6a-dihydro-3aH-furo[3,4-d][1,3]dioxol-6-yl]methyl 2-methylpropanoate.
| Compound Name | [(3aR,4S,6R,6aR)-4-(4-aminopyrrolo[2,1-f][1,2,4]triazin-7-yl)-2-methoxy-4-methyl-6,6a-dihydro-3aH-furo[3,4-d][1,3]dioxol-6-yl]methyl 2-methylpropanoate |
|---|---|
| PubChem CID | 169174127 |
| Molecular Formula | C18H24N4O6 |
| Molecular Weight | 392.41 g/mol |
| Exact Mass | 392.17 |
| IUPAC Name | [(3aR,4S,6R,6aR)-4-(4-aminopyrrolo[2,1-f][1,2,4]triazin-7-yl)-2-methoxy-4-methyl-6,6a-dihydro-3aH-furo[3,4-d][1,3]dioxol-6-yl]methyl 2-methylpropanoate |
| SMILES | COC1O[C@H]2[C@@H](O1)[C@](C)(c1ccc3c(N)ncnn13)O[C@@H]2COC(=O)C(C)C |
| InChI | InChI=1S/C18H24N4O6/c1-9(2)16(23)25-7-11-13-14(27-17(24-4)26-13)18(3,28-11)12-6-5-10-15(19)20-8-21-22(10)12/h5-6,8-9,11,13-14,17H,7H2,1-4H3,(H2,19,20,21)/t11-,13-,14-,17?,18+/m1/s1 |
| InChIKey | YCOIVFFVLJFGFZ-XLNGAAJASA-N |
| XLogP | 0.84 |
| TPSA | 119.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.41 |
| LogP ≤ 5 | 0.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |