C20H31FN4O3 — CID 69264266
7-[(3R,4R,5R)-4-butoxy-5-(butoxymethyl)-3-fluoro-2-methyloxolan-2-yl]pyrrolo[2,1-f][1,2,4]triazin-4-amine (PubChem CID 69264266) has the molecular formula C20H31FN4O3 and a molecular weight of 394.49 g/mol. Its IUPAC name is 7-[(3R,4R,5R)-4-butoxy-5-(butoxymethyl)-3-fluoro-2-methyloxolan-2-yl]pyrrolo[2,1-f][1,2,4]triazin-4-amine.
| Compound Name | 7-[(3R,4R,5R)-4-butoxy-5-(butoxymethyl)-3-fluoro-2-methyloxolan-2-yl]pyrrolo[2,1-f][1,2,4]triazin-4-amine |
|---|---|
| PubChem CID | 69264266 |
| Molecular Formula | C20H31FN4O3 |
| Molecular Weight | 394.49 g/mol |
| Exact Mass | 394.24 |
| IUPAC Name | 7-[(3R,4R,5R)-4-butoxy-5-(butoxymethyl)-3-fluoro-2-methyloxolan-2-yl]pyrrolo[2,1-f][1,2,4]triazin-4-amine |
| SMILES | CCCCOC[C@H]1OC(C)(c2ccc3c(N)ncnn23)[C@H](F)[C@@H]1OCCCC |
| InChI | InChI=1S/C20H31FN4O3/c1-4-6-10-26-12-15-17(27-11-7-5-2)18(21)20(3,28-15)16-9-8-14-19(22)23-13-24-25(14)16/h8-9,13,15,17-18H,4-7,10-12H2,1-3H3,(H2,22,23,24)/t15-,17-,18-,20?/m1/s1 |
| InChIKey | JGEWMIUYZNBXDT-KIAIFBHISA-N |
| XLogP | 3.27 |
| TPSA | 83.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.49 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|