C25H38N4O4 — CID 121313202
7-[(3R,4R,5R)-3,4-dibutoxy-5-(butoxymethyl)-2-ethynyloxolan-2-yl]pyrrolo[2,1-f][1,2,4]triazin-4-amine (PubChem CID 121313202) has the molecular formula C25H38N4O4 and a molecular weight of 458.60 g/mol. Its IUPAC name is 7-[(3R,4R,5R)-3,4-dibutoxy-5-(butoxymethyl)-2-ethynyloxolan-2-yl]pyrrolo[2,1-f][1,2,4]triazin-4-amine.
| Compound Name | 7-[(3R,4R,5R)-3,4-dibutoxy-5-(butoxymethyl)-2-ethynyloxolan-2-yl]pyrrolo[2,1-f][1,2,4]triazin-4-amine |
|---|---|
| PubChem CID | 121313202 |
| Molecular Formula | C25H38N4O4 |
| Molecular Weight | 458.60 g/mol |
| Exact Mass | 458.29 |
| IUPAC Name | 7-[(3R,4R,5R)-3,4-dibutoxy-5-(butoxymethyl)-2-ethynyloxolan-2-yl]pyrrolo[2,1-f][1,2,4]triazin-4-amine |
| SMILES | C#CC1(c2ccc3c(N)ncnn23)O[C@H](COCCCC)[C@@H](OCCCC)[C@H]1OCCCC |
| InChI | InChI=1S/C25H38N4O4/c1-5-9-14-30-17-20-22(31-15-10-6-2)23(32-16-11-7-3)25(8-4,33-20)21-13-12-19-24(26)27-18-28-29(19)21/h4,12-13,18,20,22-23H,5-7,9-11,14-17H2,1-3H3,(H2,26,27,28)/t20-,22-,23-,25?/m1/s1 |
| InChIKey | KXXIUVLGYFVPKB-JNVIOWGCSA-N |
| XLogP | 3.73 |
| TPSA | 93.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.60 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|