C34H35N5O4 — CID 134443534
7-[(2R,3R,4R,5R)-2-(methyliminomethyl)-3,4-bis(phenylmethoxy)-5-(phenylmethoxymethyl)oxolan-2-yl]pyrrolo[2,1-f][1,2,4]triazin-4-amine (PubChem CID 134443534) has the molecular formula C34H35N5O4 and a molecular weight of 577.69 g/mol. Its IUPAC name is 7-[(2R,3R,4R,5R)-2-(methyliminomethyl)-3,4-bis(phenylmethoxy)-5-(phenylmethoxymethyl)oxolan-2-yl]pyrrolo[2,1-f][1,2,4]triazin-4-amine.
| Compound Name | 7-[(2R,3R,4R,5R)-2-(methyliminomethyl)-3,4-bis(phenylmethoxy)-5-(phenylmethoxymethyl)oxolan-2-yl]pyrrolo[2,1-f][1,2,4]triazin-4-amine |
|---|---|
| PubChem CID | 134443534 |
| Molecular Formula | C34H35N5O4 |
| Molecular Weight | 577.69 g/mol |
| Exact Mass | 577.27 |
| IUPAC Name | 7-[(2R,3R,4R,5R)-2-(methyliminomethyl)-3,4-bis(phenylmethoxy)-5-(phenylmethoxymethyl)oxolan-2-yl]pyrrolo[2,1-f][1,2,4]triazin-4-amine |
| SMILES | C/N=C/[C@@]1(c2ccc3c(N)ncnn23)O[C@H](COCc2ccccc2)[C@@H](OCc2ccccc2)[C@H]1OCc1ccccc1 |
| InChI | InChI=1S/C34H35N5O4/c1-36-23-34(30-18-17-28-33(35)37-24-38-39(28)30)32(42-21-27-15-9-4-10-16-27)31(41-20-26-13-7-3-8-14-26)29(43-34)22-40-19-25-11-5-2-6-12-25/h2-18,23-24,29,31-32H,19-22H2,1H3,(H2,35,37,38)/b36-23+/t29-,31-,32-,34+/m1/s1 |
| InChIKey | TWEZGETZXMSAIQ-WTPMLUOUSA-N |
| XLogP | 4.99 |
| TPSA | 105.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 577.69 |
| LogP ≤ 5 | 4.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|