C39H38N4O5 — CID 166673154
7-[(3R,4R,5R)-2,3,4-tris(phenylmethoxy)-5-(phenylmethoxymethyl)oxolan-2-yl]pyrrolo[2,1-f][1,2,4]triazin-4-amine (PubChem CID 166673154) has the molecular formula C39H38N4O5 and a molecular weight of 642.76 g/mol. Its IUPAC name is 7-[(3R,4R,5R)-2,3,4-tris(phenylmethoxy)-5-(phenylmethoxymethyl)oxolan-2-yl]pyrrolo[2,1-f][1,2,4]triazin-4-amine.
| Compound Name | 7-[(3R,4R,5R)-2,3,4-tris(phenylmethoxy)-5-(phenylmethoxymethyl)oxolan-2-yl]pyrrolo[2,1-f][1,2,4]triazin-4-amine |
|---|---|
| PubChem CID | 166673154 |
| Molecular Formula | C39H38N4O5 |
| Molecular Weight | 642.76 g/mol |
| Exact Mass | 642.28 |
| IUPAC Name | 7-[(3R,4R,5R)-2,3,4-tris(phenylmethoxy)-5-(phenylmethoxymethyl)oxolan-2-yl]pyrrolo[2,1-f][1,2,4]triazin-4-amine |
| SMILES | Nc1ncnn2c(C3(OCc4ccccc4)O[C@H](COCc4ccccc4)[C@@H](OCc4ccccc4)[C@H]3OCc3ccccc3)ccc12 |
| InChI | InChI=1S/C39H38N4O5/c40-38-33-21-22-35(43(33)42-28-41-38)39(47-26-32-19-11-4-12-20-32)37(46-25-31-17-9-3-10-18-31)36(45-24-30-15-7-2-8-16-30)34(48-39)27-44-23-29-13-5-1-6-14-29/h1-22,28,34,36-37H,23-27H2,(H2,40,41,42)/t34-,36-,37-,39?/m1/s1 |
| InChIKey | JQYKHMSQZXTVJA-JRVGLACRSA-N |
| XLogP | 6.47 |
| TPSA | 102.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 642.76 |
| LogP ≤ 5 | 6.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |