C32H33N5O5 — CID 58527288
(3R,4R,5R)-2-(4-aminoimidazo[2,1-f][1,2,4]triazin-7-yl)-3-methyl-3,4-bis(phenylmethoxy)-5-(phenylmethoxymethyl)oxolan-2-ol (PubChem CID 58527288) has the molecular formula C32H33N5O5 and a molecular weight of 567.65 g/mol. Its IUPAC name is (3R,4R,5R)-2-(4-aminoimidazo[2,1-f][1,2,4]triazin-7-yl)-3-methyl-3,4-bis(phenylmethoxy)-5-(phenylmethoxymethyl)oxolan-2-ol.
| Compound Name | (3R,4R,5R)-2-(4-aminoimidazo[2,1-f][1,2,4]triazin-7-yl)-3-methyl-3,4-bis(phenylmethoxy)-5-(phenylmethoxymethyl)oxolan-2-ol |
|---|---|
| PubChem CID | 58527288 |
| Molecular Formula | C32H33N5O5 |
| Molecular Weight | 567.65 g/mol |
| Exact Mass | 567.25 |
| IUPAC Name | (3R,4R,5R)-2-(4-aminoimidazo[2,1-f][1,2,4]triazin-7-yl)-3-methyl-3,4-bis(phenylmethoxy)-5-(phenylmethoxymethyl)oxolan-2-ol |
| SMILES | C[C@@]1(OCc2ccccc2)[C@H](OCc2ccccc2)[C@@H](COCc2ccccc2)OC1(O)c1cnc2c(N)ncnn12 |
| InChI | InChI=1S/C32H33N5O5/c1-31(41-20-25-15-9-4-10-16-25)28(40-19-24-13-7-3-8-14-24)26(21-39-18-23-11-5-2-6-12-23)42-32(31,38)27-17-34-30-29(33)35-22-36-37(27)30/h2-17,22,26,28,38H,18-21H2,1H3,(H2,33,35,36)/t26-,28-,31-,32?/m1/s1 |
| InChIKey | OCJVAUZNKRRMDZ-LLHWKEBFSA-N |
| XLogP | 4.03 |
| TPSA | 126.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 567.65 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |