C34H35N3O5S — CID 91277027
2-(4-aminothieno[3,4-d]pyrimidin-7-yl)-3-methyl-3,4-bis(phenylmethoxy)-5-(2-phenylmethoxyethyl)oxolan-2-ol (PubChem CID 91277027) has the molecular formula C34H35N3O5S and a molecular weight of 597.74 g/mol. Its IUPAC name is 2-(4-aminothieno[3,4-d]pyrimidin-7-yl)-3-methyl-3,4-bis(phenylmethoxy)-5-(2-phenylmethoxyethyl)oxolan-2-ol.
| Compound Name | 2-(4-aminothieno[3,4-d]pyrimidin-7-yl)-3-methyl-3,4-bis(phenylmethoxy)-5-(2-phenylmethoxyethyl)oxolan-2-ol |
|---|---|
| PubChem CID | 91277027 |
| Molecular Formula | C34H35N3O5S |
| Molecular Weight | 597.74 g/mol |
| Exact Mass | 597.23 |
| IUPAC Name | 2-(4-aminothieno[3,4-d]pyrimidin-7-yl)-3-methyl-3,4-bis(phenylmethoxy)-5-(2-phenylmethoxyethyl)oxolan-2-ol |
| SMILES | CC1(OCc2ccccc2)C(OCc2ccccc2)C(CCOCc2ccccc2)OC1(O)c1scc2c(N)ncnc12 |
| InChI | InChI=1S/C34H35N3O5S/c1-33(41-21-26-15-9-4-10-16-26)30(40-20-25-13-7-3-8-14-25)28(17-18-39-19-24-11-5-2-6-12-24)42-34(33,38)31-29-27(22-43-31)32(35)37-23-36-29/h2-16,22-23,28,30,38H,17-21H2,1H3,(H2,35,36,37) |
| InChIKey | RXKYLIACDSTCPP-UHFFFAOYSA-N |
| XLogP | 5.99 |
| TPSA | 108.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 597.74 |
| LogP ≤ 5 | 5.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|