C17H15F2N5O — CID 11078416
9-[[3,3-difluoro-2-(phenylmethoxymethyl)cyclopropen-1-yl]methyl]purin-6-amine (PubChem CID 11078416) has the molecular formula C17H15F2N5O and a molecular weight of 343.34 g/mol. Its IUPAC name is 9-[[3,3-difluoro-2-(phenylmethoxymethyl)cyclopropen-1-yl]methyl]purin-6-amine.
| Compound Name | 9-[[3,3-difluoro-2-(phenylmethoxymethyl)cyclopropen-1-yl]methyl]purin-6-amine |
|---|---|
| PubChem CID | 11078416 |
| Molecular Formula | C17H15F2N5O |
| Molecular Weight | 343.34 g/mol |
| Exact Mass | 343.12 |
| IUPAC Name | 9-[[3,3-difluoro-2-(phenylmethoxymethyl)cyclopropen-1-yl]methyl]purin-6-amine |
| SMILES | Nc1ncnc2c1ncn2CC1=C(COCc2ccccc2)C1(F)F |
| InChI | InChI=1S/C17H15F2N5O/c18-17(19)12(13(17)8-25-7-11-4-2-1-3-5-11)6-24-10-23-14-15(20)21-9-22-16(14)24/h1-5,9-10H,6-8H2,(H2,20,21,22) |
| InChIKey | SLWITBBOBLZJMN-UHFFFAOYSA-N |
| XLogP | 2.57 |
| TPSA | 78.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.34 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|