C12H12BN5O3 — CID 169006248
[4-[(6-aminopurin-9-yl)methyl]phenoxy]boronic acid (PubChem CID 169006248) has the molecular formula C12H12BN5O3 and a molecular weight of 285.07 g/mol. Its IUPAC name is [4-[(6-aminopurin-9-yl)methyl]phenoxy]boronic acid.
| Compound Name | [4-[(6-aminopurin-9-yl)methyl]phenoxy]boronic acid |
|---|---|
| PubChem CID | 169006248 |
| Molecular Formula | C12H12BN5O3 |
| Molecular Weight | 285.07 g/mol |
| Exact Mass | 285.10 |
| IUPAC Name | [4-[(6-aminopurin-9-yl)methyl]phenoxy]boronic acid |
| SMILES | Nc1ncnc2c1ncn2Cc1ccc(OB(O)O)cc1 |
| InChI | InChI=1S/C12H12BN5O3/c14-11-10-12(16-6-15-11)18(7-17-10)5-8-1-3-9(4-2-8)21-13(19)20/h1-4,6-7,19-20H,5H2,(H2,14,15,16) |
| InChIKey | IDZDNTCTWLKZQE-UHFFFAOYSA-N |
| XLogP | -0.19 |
| TPSA | 119.31 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.07 |
| LogP ≤ 5 | -0.19 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|