C15H18ClN5O2 — CID 126459868
9-[2-(4-ethoxyphenoxy)ethyl]purin-6-amine;hydrochloride (PubChem CID 126459868) has the molecular formula C15H18ClN5O2 and a molecular weight of 335.80 g/mol. Its IUPAC name is 9-[2-(4-ethoxyphenoxy)ethyl]purin-6-amine;hydrochloride.
| Compound Name | 9-[2-(4-ethoxyphenoxy)ethyl]purin-6-amine;hydrochloride |
|---|---|
| PubChem CID | 126459868 |
| Molecular Formula | C15H18ClN5O2 |
| Molecular Weight | 335.80 g/mol |
| Exact Mass | 335.11 |
| IUPAC Name | 9-[2-(4-ethoxyphenoxy)ethyl]purin-6-amine;hydrochloride |
| SMILES | CCOc1ccc(OCCn2cnc3c(N)ncnc32)cc1.Cl |
| InChI | InChI=1S/C15H17N5O2.ClH/c1-2-21-11-3-5-12(6-4-11)22-8-7-20-10-19-13-14(16)17-9-18-15(13)20;/h3-6,9-10H,2,7-8H2,1H3,(H2,16,17,18);1H |
| InChIKey | JLFJNKGTQNDLTQ-UHFFFAOYSA-N |
| XLogP | 2.31 |
| TPSA | 88.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.80 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |