C16H20N5O4P — CID 46185962
[4-[4-(6-aminopurin-9-yl)butoxy]phenyl]methylphosphonic acid (PubChem CID 46185962) has the molecular formula C16H20N5O4P and a molecular weight of 377.34 g/mol. Its IUPAC name is [4-[4-(6-aminopurin-9-yl)butoxy]phenyl]methylphosphonic acid.
| Compound Name | [4-[4-(6-aminopurin-9-yl)butoxy]phenyl]methylphosphonic acid |
|---|---|
| PubChem CID | 46185962 |
| Molecular Formula | C16H20N5O4P |
| Molecular Weight | 377.34 g/mol |
| Exact Mass | 377.13 |
| IUPAC Name | [4-[4-(6-aminopurin-9-yl)butoxy]phenyl]methylphosphonic acid |
| SMILES | Nc1ncnc2c1ncn2CCCCOc1ccc(CP(=O)(O)O)cc1 |
| InChI | InChI=1S/C16H20N5O4P/c17-15-14-16(19-10-18-15)21(11-20-14)7-1-2-8-25-13-5-3-12(4-6-13)9-26(22,23)24/h3-6,10-11H,1-2,7-9H2,(H2,17,18,19)(H2,22,23,24) |
| InChIKey | WHHGMYUGTIXNIJ-UHFFFAOYSA-N |
| XLogP | 1.95 |
| TPSA | 136.38 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.34 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|