C23H32N5O5P — CID 46183235
1-[2-[5-(6-aminopurin-9-yl)pentoxy]-5-(diethoxyphosphorylmethyl)phenyl]ethanone (PubChem CID 46183235) has the molecular formula C23H32N5O5P and a molecular weight of 489.51 g/mol. Its IUPAC name is 1-[2-[5-(6-aminopurin-9-yl)pentoxy]-5-(diethoxyphosphorylmethyl)phenyl]ethanone.
| Compound Name | 1-[2-[5-(6-aminopurin-9-yl)pentoxy]-5-(diethoxyphosphorylmethyl)phenyl]ethanone |
|---|---|
| PubChem CID | 46183235 |
| Molecular Formula | C23H32N5O5P |
| Molecular Weight | 489.51 g/mol |
| Exact Mass | 489.21 |
| IUPAC Name | 1-[2-[5-(6-aminopurin-9-yl)pentoxy]-5-(diethoxyphosphorylmethyl)phenyl]ethanone |
| SMILES | CCOP(=O)(Cc1ccc(OCCCCCn2cnc3c(N)ncnc32)c(C(C)=O)c1)OCC |
| InChI | InChI=1S/C23H32N5O5P/c1-4-32-34(30,33-5-2)14-18-9-10-20(19(13-18)17(3)29)31-12-8-6-7-11-28-16-27-21-22(24)25-15-26-23(21)28/h9-10,13,15-16H,4-8,11-12,14H2,1-3H3,(H2,24,25,26) |
| InChIKey | VWMOULMZOXJXBP-UHFFFAOYSA-N |
| XLogP | 4.63 |
| TPSA | 131.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.51 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|