C21H30N5O4P — CID 46186476
9-[5-[2-(diethoxyphosphorylmethyl)phenoxy]pentyl]purin-6-amine (PubChem CID 46186476) has the molecular formula C21H30N5O4P and a molecular weight of 447.48 g/mol. Its IUPAC name is 9-[5-[2-(diethoxyphosphorylmethyl)phenoxy]pentyl]purin-6-amine.
| Compound Name | 9-[5-[2-(diethoxyphosphorylmethyl)phenoxy]pentyl]purin-6-amine |
|---|---|
| PubChem CID | 46186476 |
| Molecular Formula | C21H30N5O4P |
| Molecular Weight | 447.48 g/mol |
| Exact Mass | 447.20 |
| IUPAC Name | 9-[5-[2-(diethoxyphosphorylmethyl)phenoxy]pentyl]purin-6-amine |
| SMILES | CCOP(=O)(Cc1ccccc1OCCCCCn1cnc2c(N)ncnc21)OCC |
| InChI | InChI=1S/C21H30N5O4P/c1-3-29-31(27,30-4-2)14-17-10-6-7-11-18(17)28-13-9-5-8-12-26-16-25-19-20(22)23-15-24-21(19)26/h6-7,10-11,15-16H,3-5,8-9,12-14H2,1-2H3,(H2,22,23,24) |
| InChIKey | OYBLVFOWXDQVPJ-UHFFFAOYSA-N |
| XLogP | 4.42 |
| TPSA | 114.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.48 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|