C29H41FN5O8P — CID 46184193
[[4-[5-(6-aminopurin-9-yl)pentoxy]-3-fluorophenyl]methyl-(2,2-dimethylpropanoyloxymethoxy)phosphoryl]oxymethyl 2,2-dimethylpropanoate (PubChem CID 46184193) has the molecular formula C29H41FN5O8P and a molecular weight of 637.65 g/mol. Its IUPAC name is [[4-[5-(6-aminopurin-9-yl)pentoxy]-3-fluorophenyl]methyl-(2,2-dimethylpropanoyloxymethoxy)phosphoryl]oxymethyl 2,2-dimethylpropanoate.
| Compound Name | [[4-[5-(6-aminopurin-9-yl)pentoxy]-3-fluorophenyl]methyl-(2,2-dimethylpropanoyloxymethoxy)phosphoryl]oxymethyl 2,2-dimethylpropanoate |
|---|---|
| PubChem CID | 46184193 |
| Molecular Formula | C29H41FN5O8P |
| Molecular Weight | 637.65 g/mol |
| Exact Mass | 637.27 |
| IUPAC Name | [[4-[5-(6-aminopurin-9-yl)pentoxy]-3-fluorophenyl]methyl-(2,2-dimethylpropanoyloxymethoxy)phosphoryl]oxymethyl 2,2-dimethylpropanoate |
| SMILES | CC(C)(C)C(=O)OCOP(=O)(Cc1ccc(OCCCCCn2cnc3c(N)ncnc32)c(F)c1)OCOC(=O)C(C)(C)C |
| InChI | InChI=1S/C29H41FN5O8P/c1-28(2,3)26(36)40-18-42-44(38,43-19-41-27(37)29(4,5)6)15-20-10-11-22(21(30)14-20)39-13-9-7-8-12-35-17-34-23-24(31)32-16-33-25(23)35/h10-11,14,16-17H,7-9,12-13,15,18-19H2,1-6H3,(H2,31,32,33) |
| InChIKey | MQUHSDHIBRIAFF-UHFFFAOYSA-N |
| XLogP | 5.62 |
| TPSA | 166.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 44 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 637.65 |
| LogP ≤ 5 | 5.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|