C50H82N10O20P2 — CID 57381205
bis([2-(6-aminopurin-9-yl)ethoxymethyl-(2,2-dimethylpropanoyloxymethoxy)phosphoryl]oxymethyl 2,2-dimethylpropanoate);decanedioic acid (PubChem CID 57381205) has the molecular formula C50H82N10O20P2 and a molecular weight of 1205.20 g/mol. Its IUPAC name is bis([2-(6-aminopurin-9-yl)ethoxymethyl-(2,2-dimethylpropanoyloxymethoxy)phosphoryl]oxymethyl 2,2-dimethylpropanoate);decanedioic acid.
| Compound Name | bis([2-(6-aminopurin-9-yl)ethoxymethyl-(2,2-dimethylpropanoyloxymethoxy)phosphoryl]oxymethyl 2,2-dimethylpropanoate);decanedioic acid |
|---|---|
| PubChem CID | 57381205 |
| Molecular Formula | C50H82N10O20P2 |
| Molecular Weight | 1205.20 g/mol |
| Exact Mass | 1204.52 |
| IUPAC Name | bis([2-(6-aminopurin-9-yl)ethoxymethyl-(2,2-dimethylpropanoyloxymethoxy)phosphoryl]oxymethyl 2,2-dimethylpropanoate);decanedioic acid |
| SMILES | CC(C)(C)C(=O)OCOP(=O)(COCCn1cnc2c(N)ncnc21)OCOC(=O)C(C)(C)C.CC(C)(C)C(=O)OCOP(=O)(COCCn1cnc2c(N)ncnc21)OCOC(=O)C(C)(C)C.O=C(O)CCCCCCCCC(=O)O |
| InChI | InChI=1S/2C20H32N5O8P.C10H18O4/c2*1-19(2,3)17(26)30-11-32-34(28,33-12-31-18(27)20(4,5)6)13-29-8-7-25-10-24-14-15(21)22-9-23-16(14)25;11-9(12)7-5-3-1-2-4-6-8-10(13)14/h2*9-10H,7-8,11-13H2,1-6H3,(H2,21,22,23);1-8H2,(H,11,12)(H,13,14) |
| InChIKey | FRKYZRANMJMJCN-UHFFFAOYSA-N |
| XLogP | 7.68 |
| TPSA | 408.56 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 28 |
| Rotatable Bonds | 31 |
| Heavy Atoms | 82 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1205.20 |
| LogP ≤ 5 | 7.68 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 28 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|