C28H35ClN7O8P — CID 45265908
[[(2S)-2-amino-3-phenylpropanoyl]oxymethoxy-[2-(6-aminopurin-9-yl)ethoxymethyl]phosphoryl]oxymethyl (2S)-2-amino-3-phenylpropanoate;hydrochloride (PubChem CID 45265908) has the molecular formula C28H35ClN7O8P and a molecular weight of 664.06 g/mol. Its IUPAC name is [[(2S)-2-amino-3-phenylpropanoyl]oxymethoxy-[2-(6-aminopurin-9-yl)ethoxymethyl]phosphoryl]oxymethyl (2S)-2-amino-3-phenylpropanoate;hydrochloride.
| Compound Name | [[(2S)-2-amino-3-phenylpropanoyl]oxymethoxy-[2-(6-aminopurin-9-yl)ethoxymethyl]phosphoryl]oxymethyl (2S)-2-amino-3-phenylpropanoate;hydrochloride |
|---|---|
| PubChem CID | 45265908 |
| Molecular Formula | C28H35ClN7O8P |
| Molecular Weight | 664.06 g/mol |
| Exact Mass | 663.20 |
| IUPAC Name | [[(2S)-2-amino-3-phenylpropanoyl]oxymethoxy-[2-(6-aminopurin-9-yl)ethoxymethyl]phosphoryl]oxymethyl (2S)-2-amino-3-phenylpropanoate;hydrochloride |
| SMILES | Cl.Nc1ncnc2c1ncn2CCOCP(=O)(OCOC(=O)[C@@H](N)Cc1ccccc1)OCOC(=O)[C@@H](N)Cc1ccccc1 |
| InChI | InChI=1S/C28H34N7O8P.ClH/c29-22(13-20-7-3-1-4-8-20)27(36)40-17-42-44(38,43-18-41-28(37)23(30)14-21-9-5-2-6-10-21)19-39-12-11-35-16-34-24-25(31)32-15-33-26(24)35;/h1-10,15-16,22-23H,11-14,17-19,29-30H2,(H2,31,32,33);1H/t22-,23-;/m0./s1 |
| InChIKey | ASDJWQUUEUOUBE-SJEIDVEUSA-N |
| XLogP | 2.17 |
| TPSA | 219.02 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 15 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 664.06 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 15 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|