C32H40N5O16P — CID 70674611
9-[2-[bis(2-ethoxyphenoxy)phosphorylmethoxy]ethyl]purin-6-amine;bis(2-hydroxybutanedioic acid) (PubChem CID 70674611) has the molecular formula C32H40N5O16P and a molecular weight of 781.66 g/mol. Its IUPAC name is 9-[2-[bis(2-ethoxyphenoxy)phosphorylmethoxy]ethyl]purin-6-amine;bis(2-hydroxybutanedioic acid).
| Compound Name | 9-[2-[bis(2-ethoxyphenoxy)phosphorylmethoxy]ethyl]purin-6-amine;bis(2-hydroxybutanedioic acid) |
|---|---|
| PubChem CID | 70674611 |
| Molecular Formula | C32H40N5O16P |
| Molecular Weight | 781.66 g/mol |
| Exact Mass | 781.22 |
| IUPAC Name | 9-[2-[bis(2-ethoxyphenoxy)phosphorylmethoxy]ethyl]purin-6-amine;bis(2-hydroxybutanedioic acid) |
| SMILES | CCOc1ccccc1OP(=O)(COCCn1cnc2c(N)ncnc21)Oc1ccccc1OCC.O=C(O)CC(O)C(=O)O.O=C(O)CC(O)C(=O)O |
| InChI | InChI=1S/C24H28N5O6P.2C4H6O5/c1-3-32-18-9-5-7-11-20(18)34-36(30,35-21-12-8-6-10-19(21)33-4-2)17-31-14-13-29-16-28-22-23(25)26-15-27-24(22)29;2*5-2(4(8)9)1-3(6)7/h5-12,15-16H,3-4,13-14,17H2,1-2H3,(H2,25,26,27);2*2,5H,1H2,(H,6,7)(H,8,9) |
| InChIKey | CZDGNAAPJVMTAP-UHFFFAOYSA-N |
| XLogP | 2.34 |
| TPSA | 322.50 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 17 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 54 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 781.66 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 17 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|