C19H34N5O4P — CID 142409966
9-[2-[[decoxy(methoxy)phosphoryl]methoxy]ethyl]purin-6-amine (PubChem CID 142409966) has the molecular formula C19H34N5O4P and a molecular weight of 427.49 g/mol. Its IUPAC name is 9-[2-[[decoxy(methoxy)phosphoryl]methoxy]ethyl]purin-6-amine.
| Compound Name | 9-[2-[[decoxy(methoxy)phosphoryl]methoxy]ethyl]purin-6-amine |
|---|---|
| PubChem CID | 142409966 |
| Molecular Formula | C19H34N5O4P |
| Molecular Weight | 427.49 g/mol |
| Exact Mass | 427.23 |
| IUPAC Name | 9-[2-[[decoxy(methoxy)phosphoryl]methoxy]ethyl]purin-6-amine |
| SMILES | CCCCCCCCCCOP(=O)(COCCn1cnc2c(N)ncnc21)OC |
| InChI | InChI=1S/C19H34N5O4P/c1-3-4-5-6-7-8-9-10-12-28-29(25,26-2)16-27-13-11-24-15-23-17-18(20)21-14-22-19(17)24/h14-15H,3-13,16H2,1-2H3,(H2,20,21,22) |
| InChIKey | GREWICSEVICIIW-UHFFFAOYSA-N |
| XLogP | 4.38 |
| TPSA | 114.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.49 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|