C15H19N10O3P — CID 175273885
9-[2-[2-(6-aminopurin-9-yl)ethoxy-methylphosphoryl]oxyethyl]purin-6-amine (PubChem CID 175273885) has the molecular formula C15H19N10O3P and a molecular weight of 418.36 g/mol. Its IUPAC name is 9-[2-[2-(6-aminopurin-9-yl)ethoxy-methylphosphoryl]oxyethyl]purin-6-amine.
| Compound Name | 9-[2-[2-(6-aminopurin-9-yl)ethoxy-methylphosphoryl]oxyethyl]purin-6-amine |
|---|---|
| PubChem CID | 175273885 |
| Molecular Formula | C15H19N10O3P |
| Molecular Weight | 418.36 g/mol |
| Exact Mass | 418.14 |
| IUPAC Name | 9-[2-[2-(6-aminopurin-9-yl)ethoxy-methylphosphoryl]oxyethyl]purin-6-amine |
| SMILES | CP(=O)(OCCn1cnc2c(N)ncnc21)OCCn1cnc2c(N)ncnc21 |
| InChI | InChI=1S/C15H19N10O3P/c1-29(26,27-4-2-24-8-22-10-12(16)18-6-20-14(10)24)28-5-3-25-9-23-11-13(17)19-7-21-15(11)25/h6-9H,2-5H2,1H3,(H2,16,18,20)(H2,17,19,21) |
| InChIKey | AOSWIRFZAPYNQX-UHFFFAOYSA-N |
| XLogP | 0.69 |
| TPSA | 174.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.36 |
| LogP ≤ 5 | 0.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|