C12H20N5O3PS — CID 10088910
9-[2-(diethoxyphosphorylmethylsulfanyl)ethyl]purin-6-amine (PubChem CID 10088910) has the molecular formula C12H20N5O3PS and a molecular weight of 345.37 g/mol. Its IUPAC name is 9-[2-(diethoxyphosphorylmethylsulfanyl)ethyl]purin-6-amine.
| Compound Name | 9-[2-(diethoxyphosphorylmethylsulfanyl)ethyl]purin-6-amine |
|---|---|
| PubChem CID | 10088910 |
| Molecular Formula | C12H20N5O3PS |
| Molecular Weight | 345.37 g/mol |
| Exact Mass | 345.10 |
| IUPAC Name | 9-[2-(diethoxyphosphorylmethylsulfanyl)ethyl]purin-6-amine |
| SMILES | CCOP(=O)(CSCCn1cnc2c(N)ncnc21)OCC |
| InChI | InChI=1S/C12H20N5O3PS/c1-3-19-21(18,20-4-2)9-22-6-5-17-8-16-10-11(13)14-7-15-12(10)17/h7-8H,3-6,9H2,1-2H3,(H2,13,14,15) |
| InChIKey | LVGJOJNGZSALCP-UHFFFAOYSA-N |
| XLogP | 2.37 |
| TPSA | 105.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.37 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|