C14H24N5O5P — CID 19808652
2-[(6-aminopurin-9-yl)oxymethyl]-4-diethoxyphosphorylbutan-1-ol (PubChem CID 19808652) has the molecular formula C14H24N5O5P and a molecular weight of 373.35 g/mol. Its IUPAC name is 2-[(6-aminopurin-9-yl)oxymethyl]-4-diethoxyphosphorylbutan-1-ol.
| Compound Name | 2-[(6-aminopurin-9-yl)oxymethyl]-4-diethoxyphosphorylbutan-1-ol |
|---|---|
| PubChem CID | 19808652 |
| Molecular Formula | C14H24N5O5P |
| Molecular Weight | 373.35 g/mol |
| Exact Mass | 373.15 |
| IUPAC Name | 2-[(6-aminopurin-9-yl)oxymethyl]-4-diethoxyphosphorylbutan-1-ol |
| SMILES | CCOP(=O)(CCC(CO)COn1cnc2c(N)ncnc21)OCC |
| InChI | InChI=1S/C14H24N5O5P/c1-3-23-25(21,24-4-2)6-5-11(7-20)8-22-19-10-18-12-13(15)16-9-17-14(12)19/h9-11,20H,3-8H2,1-2H3,(H2,15,16,17) |
| InChIKey | IAUVTAGLFPXRRN-UHFFFAOYSA-N |
| XLogP | 1.10 |
| TPSA | 134.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.35 |
| LogP ≤ 5 | 1.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|