C11H18N5O6P — CID 54445311
[1-(6-aminopurin-9-yl)oxy-3-hydroxypropan-2-yl]oxymethyl-ethoxyphosphinic acid (PubChem CID 54445311) has the molecular formula C11H18N5O6P and a molecular weight of 347.27 g/mol. Its IUPAC name is [1-(6-aminopurin-9-yl)oxy-3-hydroxypropan-2-yl]oxymethyl-ethoxyphosphinic acid.
| Compound Name | [1-(6-aminopurin-9-yl)oxy-3-hydroxypropan-2-yl]oxymethyl-ethoxyphosphinic acid |
|---|---|
| PubChem CID | 54445311 |
| Molecular Formula | C11H18N5O6P |
| Molecular Weight | 347.27 g/mol |
| Exact Mass | 347.10 |
| IUPAC Name | [1-(6-aminopurin-9-yl)oxy-3-hydroxypropan-2-yl]oxymethyl-ethoxyphosphinic acid |
| SMILES | CCOP(=O)(O)COC(CO)COn1cnc2c(N)ncnc21 |
| InChI | InChI=1S/C11H18N5O6P/c1-2-22-23(18,19)7-20-8(3-17)4-21-16-6-15-9-10(12)13-5-14-11(9)16/h5-6,8,17H,2-4,7H2,1H3,(H,18,19)(H2,12,13,14) |
| InChIKey | WRBPXYKMRNWPEX-UHFFFAOYSA-N |
| XLogP | -0.61 |
| TPSA | 154.84 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.27 |
| LogP ≤ 5 | -0.61 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|