C14H24N5O4P — CID 89080666
9-[2-(diethoxyphosphorylmethoxy)butyl]purin-6-amine (PubChem CID 89080666) has the molecular formula C14H24N5O4P and a molecular weight of 357.35 g/mol. Its IUPAC name is 9-[2-(diethoxyphosphorylmethoxy)butyl]purin-6-amine.
| Compound Name | 9-[2-(diethoxyphosphorylmethoxy)butyl]purin-6-amine |
|---|---|
| PubChem CID | 89080666 |
| Molecular Formula | C14H24N5O4P |
| Molecular Weight | 357.35 g/mol |
| Exact Mass | 357.16 |
| IUPAC Name | 9-[2-(diethoxyphosphorylmethoxy)butyl]purin-6-amine |
| SMILES | CCOP(=O)(COC(CC)Cn1cnc2c(N)ncnc21)OCC |
| InChI | InChI=1S/C14H24N5O4P/c1-4-11(21-10-24(20,22-5-2)23-6-3)7-19-9-18-12-13(15)16-8-17-14(12)19/h8-9,11H,4-7,10H2,1-3H3,(H2,15,16,17) |
| InChIKey | UDTHILBVHDYPLV-UHFFFAOYSA-N |
| XLogP | 2.43 |
| TPSA | 114.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.35 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|