C17H28N5O7P — CID 126961732
[[(2R)-1-(6-aminopurin-9-yl)propan-2-yl]oxymethyl-propoxyphosphoryl]oxymethyl propan-2-yl carbonate (PubChem CID 126961732) has the molecular formula C17H28N5O7P and a molecular weight of 445.41 g/mol. Its IUPAC name is [[(2R)-1-(6-aminopurin-9-yl)propan-2-yl]oxymethyl-propoxyphosphoryl]oxymethyl propan-2-yl carbonate.
| Compound Name | [[(2R)-1-(6-aminopurin-9-yl)propan-2-yl]oxymethyl-propoxyphosphoryl]oxymethyl propan-2-yl carbonate |
|---|---|
| PubChem CID | 126961732 |
| Molecular Formula | C17H28N5O7P |
| Molecular Weight | 445.41 g/mol |
| Exact Mass | 445.17 |
| IUPAC Name | [[(2R)-1-(6-aminopurin-9-yl)propan-2-yl]oxymethyl-propoxyphosphoryl]oxymethyl propan-2-yl carbonate |
| SMILES | CCCOP(=O)(CO[C@H](C)Cn1cnc2c(N)ncnc21)OCOC(=O)OC(C)C |
| InChI | InChI=1S/C17H28N5O7P/c1-5-6-27-30(24,28-10-25-17(23)29-12(2)3)11-26-13(4)7-22-9-21-14-15(18)19-8-20-16(14)22/h8-9,12-13H,5-7,10-11H2,1-4H3,(H2,18,19,20)/t13-,30?/m1/s1 |
| InChIKey | FJSNXUYPGZUXLI-SGSXECEGSA-N |
| XLogP | 2.93 |
| TPSA | 149.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.41 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|