C17H28N7O8P — CID 166551601
[[(2R)-1-(6-aminopurin-9-yl)propan-2-yl]oxymethyl-(dimethylcarbamoyloxymethoxy)phosphoryl]oxymethyl N,N-dimethylcarbamate (PubChem CID 166551601) has the molecular formula C17H28N7O8P and a molecular weight of 489.43 g/mol. Its IUPAC name is [[(2R)-1-(6-aminopurin-9-yl)propan-2-yl]oxymethyl-(dimethylcarbamoyloxymethoxy)phosphoryl]oxymethyl N,N-dimethylcarbamate.
| Compound Name | [[(2R)-1-(6-aminopurin-9-yl)propan-2-yl]oxymethyl-(dimethylcarbamoyloxymethoxy)phosphoryl]oxymethyl N,N-dimethylcarbamate |
|---|---|
| PubChem CID | 166551601 |
| Molecular Formula | C17H28N7O8P |
| Molecular Weight | 489.43 g/mol |
| Exact Mass | 489.17 |
| IUPAC Name | [[(2R)-1-(6-aminopurin-9-yl)propan-2-yl]oxymethyl-(dimethylcarbamoyloxymethoxy)phosphoryl]oxymethyl N,N-dimethylcarbamate |
| SMILES | C[C@H](Cn1cnc2c(N)ncnc21)OCP(=O)(OCOC(=O)N(C)C)OCOC(=O)N(C)C |
| InChI | InChI=1S/C17H28N7O8P/c1-12(6-24-8-21-13-14(18)19-7-20-15(13)24)30-11-33(27,31-9-28-16(25)22(2)3)32-10-29-17(26)23(4)5/h7-8,12H,6,9-11H2,1-5H3,(H2,18,19,20)/t12-/m1/s1 |
| InChIKey | JOIMSBUNSZWHMG-GFCCVEGCSA-N |
| XLogP | 1.31 |
| TPSA | 173.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.43 |
| LogP ≤ 5 | 1.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|