C25H38N5O8P — CID 141131132
[[(2R)-1-(6-aminopurin-9-yl)propan-2-yl]oxymethyl-(cyclohexanecarbonyloxymethoxy)phosphoryl]oxymethyl cyclohexanecarboxylate (PubChem CID 141131132) has the molecular formula C25H38N5O8P and a molecular weight of 567.58 g/mol. Its IUPAC name is [[(2R)-1-(6-aminopurin-9-yl)propan-2-yl]oxymethyl-(cyclohexanecarbonyloxymethoxy)phosphoryl]oxymethyl cyclohexanecarboxylate.
| Compound Name | [[(2R)-1-(6-aminopurin-9-yl)propan-2-yl]oxymethyl-(cyclohexanecarbonyloxymethoxy)phosphoryl]oxymethyl cyclohexanecarboxylate |
|---|---|
| PubChem CID | 141131132 |
| Molecular Formula | C25H38N5O8P |
| Molecular Weight | 567.58 g/mol |
| Exact Mass | 567.25 |
| IUPAC Name | [[(2R)-1-(6-aminopurin-9-yl)propan-2-yl]oxymethyl-(cyclohexanecarbonyloxymethoxy)phosphoryl]oxymethyl cyclohexanecarboxylate |
| SMILES | C[C@H](Cn1cnc2c(N)ncnc21)OCP(=O)(OCOC(=O)C1CCCCC1)OCOC(=O)C1CCCCC1 |
| InChI | InChI=1S/C25H38N5O8P/c1-18(12-30-14-29-21-22(26)27-13-28-23(21)30)36-17-39(33,37-15-34-24(31)19-8-4-2-5-9-19)38-16-35-25(32)20-10-6-3-7-11-20/h13-14,18-20H,2-12,15-17H2,1H3,(H2,26,27,28)/t18-/m1/s1 |
| InChIKey | IZRUALXPTISYJM-GOSISDBHSA-N |
| XLogP | 4.16 |
| TPSA | 166.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 567.58 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|