C23H34N5O7PS — CID 44512139
[[(2R)-1-(6-aminopurin-9-yl)propan-2-yl]oxymethyl-(cyclopentanecarbonyloxymethoxy)phosphinothioyl]oxymethyl cyclopentanecarboxylate (PubChem CID 44512139) has the molecular formula C23H34N5O7PS and a molecular weight of 555.59 g/mol. Its IUPAC name is [[(2R)-1-(6-aminopurin-9-yl)propan-2-yl]oxymethyl-(cyclopentanecarbonyloxymethoxy)phosphinothioyl]oxymethyl cyclopentanecarboxylate.
| Compound Name | [[(2R)-1-(6-aminopurin-9-yl)propan-2-yl]oxymethyl-(cyclopentanecarbonyloxymethoxy)phosphinothioyl]oxymethyl cyclopentanecarboxylate |
|---|---|
| PubChem CID | 44512139 |
| Molecular Formula | C23H34N5O7PS |
| Molecular Weight | 555.59 g/mol |
| Exact Mass | 555.19 |
| IUPAC Name | [[(2R)-1-(6-aminopurin-9-yl)propan-2-yl]oxymethyl-(cyclopentanecarbonyloxymethoxy)phosphinothioyl]oxymethyl cyclopentanecarboxylate |
| SMILES | C[C@H](Cn1cnc2c(N)ncnc21)OCP(=S)(OCOC(=O)C1CCCC1)OCOC(=O)C1CCCC1 |
| InChI | InChI=1S/C23H34N5O7PS/c1-16(10-28-12-27-19-20(24)25-11-26-21(19)28)33-15-36(37,34-13-31-22(29)17-6-2-3-7-17)35-14-32-23(30)18-8-4-5-9-18/h11-12,16-18H,2-10,13-15H2,1H3,(H2,24,25,26)/t16-/m1/s1 |
| InChIKey | GIKDLQZGGBUZFY-MRXNPFEDSA-N |
| XLogP | 3.50 |
| TPSA | 149.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 555.59 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|