C26H32N5O7P — CID 90429458
3-(6-aminopurin-9-yl)-2-[[(3-hydroxy-2-phenylmethoxypropoxy)-phenylmethoxyphosphoryl]methoxy]propan-1-ol (PubChem CID 90429458) has the molecular formula C26H32N5O7P and a molecular weight of 557.54 g/mol. Its IUPAC name is 3-(6-aminopurin-9-yl)-2-[[(3-hydroxy-2-phenylmethoxypropoxy)-phenylmethoxyphosphoryl]methoxy]propan-1-ol.
| Compound Name | 3-(6-aminopurin-9-yl)-2-[[(3-hydroxy-2-phenylmethoxypropoxy)-phenylmethoxyphosphoryl]methoxy]propan-1-ol |
|---|---|
| PubChem CID | 90429458 |
| Molecular Formula | C26H32N5O7P |
| Molecular Weight | 557.54 g/mol |
| Exact Mass | 557.20 |
| IUPAC Name | 3-(6-aminopurin-9-yl)-2-[[(3-hydroxy-2-phenylmethoxypropoxy)-phenylmethoxyphosphoryl]methoxy]propan-1-ol |
| SMILES | Nc1ncnc2c1ncn2CC(CO)OCP(=O)(OCc1ccccc1)OCC(CO)OCc1ccccc1 |
| InChI | InChI=1S/C26H32N5O7P/c27-25-24-26(29-17-28-25)31(18-30-24)11-22(12-32)36-19-39(34,37-15-21-9-5-2-6-10-21)38-16-23(13-33)35-14-20-7-3-1-4-8-20/h1-10,17-18,22-23,32-33H,11-16,19H2,(H2,27,28,29) |
| InChIKey | IPHQHMIRUVYCFB-UHFFFAOYSA-N |
| XLogP | 2.75 |
| TPSA | 164.07 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 557.54 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|