C15H17FN5O4P — CID 90431958
[(2R)-1-(6-aminopurin-9-yl)-3-fluoropropan-2-yl]oxymethyl-phenoxyphosphinic acid (PubChem CID 90431958) has the molecular formula C15H17FN5O4P and a molecular weight of 381.30 g/mol. Its IUPAC name is [(2R)-1-(6-aminopurin-9-yl)-3-fluoropropan-2-yl]oxymethyl-phenoxyphosphinic acid.
| Compound Name | [(2R)-1-(6-aminopurin-9-yl)-3-fluoropropan-2-yl]oxymethyl-phenoxyphosphinic acid |
|---|---|
| PubChem CID | 90431958 |
| Molecular Formula | C15H17FN5O4P |
| Molecular Weight | 381.30 g/mol |
| Exact Mass | 381.10 |
| IUPAC Name | [(2R)-1-(6-aminopurin-9-yl)-3-fluoropropan-2-yl]oxymethyl-phenoxyphosphinic acid |
| SMILES | Nc1ncnc2c1ncn2C[C@H](CF)OCP(=O)(O)Oc1ccccc1 |
| InChI | InChI=1S/C15H17FN5O4P/c16-6-12(7-21-9-20-13-14(17)18-8-19-15(13)21)24-10-26(22,23)25-11-4-2-1-3-5-11/h1-5,8-9,12H,6-7,10H2,(H,22,23)(H2,17,18,19)/t12-/m0/s1 |
| InChIKey | PHPNDTBGULHLET-LBPRGKRZSA-N |
| XLogP | 1.99 |
| TPSA | 125.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.30 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|