C29H42FN6O7P — CID 134815087
dipentyl (2S)-2-[[[1-(6-aminopurin-9-yl)-3-fluoropropan-2-yl]oxymethyl-phenoxyphosphoryl]amino]butanedioate (PubChem CID 134815087) has the molecular formula C29H42FN6O7P and a molecular weight of 636.66 g/mol. Its IUPAC name is dipentyl (2S)-2-[[[1-(6-aminopurin-9-yl)-3-fluoropropan-2-yl]oxymethyl-phenoxyphosphoryl]amino]butanedioate.
| Compound Name | dipentyl (2S)-2-[[[1-(6-aminopurin-9-yl)-3-fluoropropan-2-yl]oxymethyl-phenoxyphosphoryl]amino]butanedioate |
|---|---|
| PubChem CID | 134815087 |
| Molecular Formula | C29H42FN6O7P |
| Molecular Weight | 636.66 g/mol |
| Exact Mass | 636.28 |
| IUPAC Name | dipentyl (2S)-2-[[[1-(6-aminopurin-9-yl)-3-fluoropropan-2-yl]oxymethyl-phenoxyphosphoryl]amino]butanedioate |
| SMILES | CCCCCOC(=O)C[C@H](NP(=O)(COC(CF)Cn1cnc2c(N)ncnc21)Oc1ccccc1)C(=O)OCCCCC |
| InChI | InChI=1S/C29H42FN6O7P/c1-3-5-10-14-40-25(37)16-24(29(38)41-15-11-6-4-2)35-44(39,43-22-12-8-7-9-13-22)21-42-23(17-30)18-36-20-34-26-27(31)32-19-33-28(26)36/h7-9,12-13,19-20,23-24H,3-6,10-11,14-18,21H2,1-2H3,(H,35,39)(H2,31,32,33)/t23?,24-,44?/m0/s1 |
| InChIKey | VMYQORQZLQALHO-XALRWDGQSA-N |
| XLogP | 4.81 |
| TPSA | 169.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 636.66 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|