C24H30FN6O6P — CID 46887170
butyl (2S)-2-[[[(2R,5R)-5-(6-aminopurin-9-yl)-4-fluoro-2,5-dihydrofuran-2-yl]oxymethyl-phenoxyphosphoryl]amino]butanoate (PubChem CID 46887170) has the molecular formula C24H30FN6O6P and a molecular weight of 548.51 g/mol. Its IUPAC name is butyl (2S)-2-[[[(2R,5R)-5-(6-aminopurin-9-yl)-4-fluoro-2,5-dihydrofuran-2-yl]oxymethyl-phenoxyphosphoryl]amino]butanoate.
| Compound Name | butyl (2S)-2-[[[(2R,5R)-5-(6-aminopurin-9-yl)-4-fluoro-2,5-dihydrofuran-2-yl]oxymethyl-phenoxyphosphoryl]amino]butanoate |
|---|---|
| PubChem CID | 46887170 |
| Molecular Formula | C24H30FN6O6P |
| Molecular Weight | 548.51 g/mol |
| Exact Mass | 548.19 |
| IUPAC Name | butyl (2S)-2-[[[(2R,5R)-5-(6-aminopurin-9-yl)-4-fluoro-2,5-dihydrofuran-2-yl]oxymethyl-phenoxyphosphoryl]amino]butanoate |
| SMILES | CCCCOC(=O)[C@H](CC)NP(=O)(CO[C@@H]1C=C(F)[C@H](n2cnc3c(N)ncnc32)O1)Oc1ccccc1 |
| InChI | InChI=1S/C24H30FN6O6P/c1-3-5-11-34-24(32)18(4-2)30-38(33,37-16-9-7-6-8-10-16)15-35-19-12-17(25)23(36-19)31-14-29-20-21(26)27-13-28-22(20)31/h6-10,12-14,18-19,23H,3-5,11,15H2,1-2H3,(H,30,33)(H2,26,27,28)/t18-,19-,23+,38?/m0/s1 |
| InChIKey | CKMDLULLFJAMNU-UQNQYQRFSA-N |
| XLogP | 4.07 |
| TPSA | 152.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 548.51 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|