C24H28FN6O10P — CID 44603338
ethyl (2S)-2-[[[(2R,5R)-5-(6-aminopurin-9-yl)-4-fluoro-2,5-dihydrofuran-2-yl]oxymethyl-phenoxyphosphoryl]amino]propanoate;propanedioic acid (PubChem CID 44603338) has the molecular formula C24H28FN6O10P and a molecular weight of 610.49 g/mol. Its IUPAC name is ethyl (2S)-2-[[[(2R,5R)-5-(6-aminopurin-9-yl)-4-fluoro-2,5-dihydrofuran-2-yl]oxymethyl-phenoxyphosphoryl]amino]propanoate;propanedioic acid.
| Compound Name | ethyl (2S)-2-[[[(2R,5R)-5-(6-aminopurin-9-yl)-4-fluoro-2,5-dihydrofuran-2-yl]oxymethyl-phenoxyphosphoryl]amino]propanoate;propanedioic acid |
|---|---|
| PubChem CID | 44603338 |
| Molecular Formula | C24H28FN6O10P |
| Molecular Weight | 610.49 g/mol |
| Exact Mass | 610.16 |
| IUPAC Name | ethyl (2S)-2-[[[(2R,5R)-5-(6-aminopurin-9-yl)-4-fluoro-2,5-dihydrofuran-2-yl]oxymethyl-phenoxyphosphoryl]amino]propanoate;propanedioic acid |
| SMILES | CCOC(=O)[C@H](C)N[P@@](=O)(CO[C@@H]1C=C(F)[C@H](n2cnc3c(N)ncnc32)O1)Oc1ccccc1.O=C(O)CC(=O)O |
| InChI | InChI=1S/C21H24FN6O6P.C3H4O4/c1-3-31-21(29)13(2)27-35(30,34-14-7-5-4-6-8-14)12-32-16-9-15(22)20(33-16)28-11-26-17-18(23)24-10-25-19(17)28;4-2(5)1-3(6)7/h4-11,13,16,20H,3,12H2,1-2H3,(H,27,30)(H2,23,24,25);1H2,(H,4,5)(H,6,7)/t13-,16-,20+,35+;/m0./s1 |
| InChIKey | ZQOSHXLCCMGVSE-XBRDKGPFSA-N |
| XLogP | 2.45 |
| TPSA | 227.31 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 610.49 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|