C16H15FN5O3P — CID 137473936
9-[3-fluoro-5-(phenoxyphosphanylmethoxy)-2,5-dihydrofuran-2-yl]purin-6-amine (PubChem CID 137473936) has the molecular formula C16H15FN5O3P and a molecular weight of 375.30 g/mol. Its IUPAC name is 9-[3-fluoro-5-(phenoxyphosphanylmethoxy)-2,5-dihydrofuran-2-yl]purin-6-amine.
| Compound Name | 9-[3-fluoro-5-(phenoxyphosphanylmethoxy)-2,5-dihydrofuran-2-yl]purin-6-amine |
|---|---|
| PubChem CID | 137473936 |
| Molecular Formula | C16H15FN5O3P |
| Molecular Weight | 375.30 g/mol |
| Exact Mass | 375.09 |
| IUPAC Name | 9-[3-fluoro-5-(phenoxyphosphanylmethoxy)-2,5-dihydrofuran-2-yl]purin-6-amine |
| SMILES | Nc1ncnc2c1ncn2C1OC(OCPOc2ccccc2)C=C1F |
| InChI | InChI=1S/C16H15FN5O3P/c17-11-6-12(23-9-26-25-10-4-2-1-3-5-10)24-16(11)22-8-21-13-14(18)19-7-20-15(13)22/h1-8,12,16,26H,9H2,(H2,18,19,20) |
| InChIKey | QQANDGNICJZPKF-UHFFFAOYSA-N |
| XLogP | 2.76 |
| TPSA | 97.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.30 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|