C22H26FN6O6P — CID 166135808
ethyl (2S)-2-[[[(2R,5R)-5-(6-aminopurin-9-yl)-4-fluoro-2,5-dihydrofuran-2-yl]oxymethyl-phenoxyphosphoryl]amino]butanoate (PubChem CID 166135808) has the molecular formula C22H26FN6O6P and a molecular weight of 520.46 g/mol. Its IUPAC name is ethyl (2S)-2-[[[(2R,5R)-5-(6-aminopurin-9-yl)-4-fluoro-2,5-dihydrofuran-2-yl]oxymethyl-phenoxyphosphoryl]amino]butanoate.
| Compound Name | ethyl (2S)-2-[[[(2R,5R)-5-(6-aminopurin-9-yl)-4-fluoro-2,5-dihydrofuran-2-yl]oxymethyl-phenoxyphosphoryl]amino]butanoate |
|---|---|
| PubChem CID | 166135808 |
| Molecular Formula | C22H26FN6O6P |
| Molecular Weight | 520.46 g/mol |
| Exact Mass | 520.16 |
| IUPAC Name | ethyl (2S)-2-[[[(2R,5R)-5-(6-aminopurin-9-yl)-4-fluoro-2,5-dihydrofuran-2-yl]oxymethyl-phenoxyphosphoryl]amino]butanoate |
| SMILES | CCOC(=O)[C@H](CC)N[P@@](=O)(CO[C@@H]1C=C(F)[C@H](n2cnc3c(N)ncnc32)O1)Oc1ccccc1 |
| InChI | InChI=1S/C22H26FN6O6P/c1-3-16(22(30)32-4-2)28-36(31,35-14-8-6-5-7-9-14)13-33-17-10-15(23)21(34-17)29-12-27-18-19(24)25-11-26-20(18)29/h5-12,16-17,21H,3-4,13H2,1-2H3,(H,28,31)(H2,24,25,26)/t16-,17-,21+,36+/m0/s1 |
| InChIKey | JLSKWWFSASVMBD-RNYXXKSYSA-N |
| XLogP | 3.29 |
| TPSA | 152.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 520.46 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|