C19H19FN5O4P — CID 71036670
N-[9-[(2R,5R)-5-(dimethylphosphorylmethoxy)-3-fluoro-2,5-dihydrofuran-2-yl]purin-6-yl]benzamide (PubChem CID 71036670) has the molecular formula C19H19FN5O4P and a molecular weight of 431.36 g/mol. Its IUPAC name is N-[9-[(2R,5R)-5-(dimethylphosphorylmethoxy)-3-fluoro-2,5-dihydrofuran-2-yl]purin-6-yl]benzamide.
| Compound Name | N-[9-[(2R,5R)-5-(dimethylphosphorylmethoxy)-3-fluoro-2,5-dihydrofuran-2-yl]purin-6-yl]benzamide |
|---|---|
| PubChem CID | 71036670 |
| Molecular Formula | C19H19FN5O4P |
| Molecular Weight | 431.36 g/mol |
| Exact Mass | 431.12 |
| IUPAC Name | N-[9-[(2R,5R)-5-(dimethylphosphorylmethoxy)-3-fluoro-2,5-dihydrofuran-2-yl]purin-6-yl]benzamide |
| SMILES | CP(C)(=O)CO[C@@H]1C=C(F)[C@H](n2cnc3c(NC(=O)c4ccccc4)ncnc32)O1 |
| InChI | InChI=1S/C19H19FN5O4P/c1-30(2,27)11-28-14-8-13(20)19(29-14)25-10-23-15-16(21-9-22-17(15)25)24-18(26)12-6-4-3-5-7-12/h3-10,14,19H,11H2,1-2H3,(H,21,22,24,26)/t14-,19+/m0/s1 |
| InChIKey | FUXCVKJJZOAQIR-IFXJQAMLSA-N |
| XLogP | 3.38 |
| TPSA | 108.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.36 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|