C19H20FIN5O4P — CID 89211495
N-[9-[(2R,3R,4R,5R)-5-(dimethylphosphorylmethoxy)-3-fluoro-4-iodooxolan-2-yl]purin-6-yl]benzamide (PubChem CID 89211495) has the molecular formula C19H20FIN5O4P and a molecular weight of 559.28 g/mol. Its IUPAC name is N-[9-[(2R,3R,4R,5R)-5-(dimethylphosphorylmethoxy)-3-fluoro-4-iodooxolan-2-yl]purin-6-yl]benzamide.
| Compound Name | N-[9-[(2R,3R,4R,5R)-5-(dimethylphosphorylmethoxy)-3-fluoro-4-iodooxolan-2-yl]purin-6-yl]benzamide |
|---|---|
| PubChem CID | 89211495 |
| Molecular Formula | C19H20FIN5O4P |
| Molecular Weight | 559.28 g/mol |
| Exact Mass | 559.03 |
| IUPAC Name | N-[9-[(2R,3R,4R,5R)-5-(dimethylphosphorylmethoxy)-3-fluoro-4-iodooxolan-2-yl]purin-6-yl]benzamide |
| SMILES | CP(C)(=O)CO[C@H]1O[C@@H](n2cnc3c(NC(=O)c4ccccc4)ncnc32)[C@@H](F)[C@@H]1I |
| InChI | InChI=1S/C19H20FIN5O4P/c1-31(2,28)10-29-19-13(21)12(20)18(30-19)26-9-24-14-15(22-8-23-16(14)26)25-17(27)11-6-4-3-5-7-11/h3-9,12-13,18-19H,10H2,1-2H3,(H,22,23,25,27)/t12-,13-,18+,19-/m0/s1 |
| InChIKey | SCQCWFMFYSGTLF-WXPXUSHHSA-N |
| XLogP | 3.67 |
| TPSA | 108.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 559.28 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|