C18H16FN5O4P+ — CID 118246335
[(5R)-5-(6-benzamidopurin-9-yl)-4-fluoro-2,5-dihydrofuran-2-yl]oxymethyl-methyl-oxophosphanium (PubChem CID 118246335) has the molecular formula C18H16FN5O4P+ and a molecular weight of 416.33 g/mol. Its IUPAC name is [(5R)-5-(6-benzamidopurin-9-yl)-4-fluoro-2,5-dihydrofuran-2-yl]oxymethyl-methyl-oxophosphanium.
| Compound Name | [(5R)-5-(6-benzamidopurin-9-yl)-4-fluoro-2,5-dihydrofuran-2-yl]oxymethyl-methyl-oxophosphanium |
|---|---|
| PubChem CID | 118246335 |
| Molecular Formula | C18H16FN5O4P+ |
| Molecular Weight | 416.33 g/mol |
| Exact Mass | 416.09 |
| IUPAC Name | [(5R)-5-(6-benzamidopurin-9-yl)-4-fluoro-2,5-dihydrofuran-2-yl]oxymethyl-methyl-oxophosphanium |
| SMILES | C[P+](=O)COC1C=C(F)[C@H](n2cnc3c(NC(=O)c4ccccc4)ncnc32)O1 |
| InChI | InChI=1S/C18H15FN5O4P/c1-29(26)10-27-13-7-12(19)18(28-13)24-9-22-14-15(20-8-21-16(14)24)23-17(25)11-5-3-2-4-6-11/h2-9,13,18H,10H2,1H3/p+1/t13?,18-/m1/s1 |
| InChIKey | UZEBCAMPGQROLE-PQJIZZRHSA-O |
| XLogP | 3.22 |
| TPSA | 108.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.33 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|