C24H27N6O5P — CID 171628938
ethyl (2S)-2-[[[(1S,4R)-4-(6-aminopurin-9-yl)-1-ethynylcyclopent-2-en-1-yl]oxymethyl-phenoxyphosphoryl]amino]propanoate (PubChem CID 171628938) has the molecular formula C24H27N6O5P and a molecular weight of 510.49 g/mol. Its IUPAC name is ethyl (2S)-2-[[[(1S,4R)-4-(6-aminopurin-9-yl)-1-ethynylcyclopent-2-en-1-yl]oxymethyl-phenoxyphosphoryl]amino]propanoate.
| Compound Name | ethyl (2S)-2-[[[(1S,4R)-4-(6-aminopurin-9-yl)-1-ethynylcyclopent-2-en-1-yl]oxymethyl-phenoxyphosphoryl]amino]propanoate |
|---|---|
| PubChem CID | 171628938 |
| Molecular Formula | C24H27N6O5P |
| Molecular Weight | 510.49 g/mol |
| Exact Mass | 510.18 |
| IUPAC Name | ethyl (2S)-2-[[[(1S,4R)-4-(6-aminopurin-9-yl)-1-ethynylcyclopent-2-en-1-yl]oxymethyl-phenoxyphosphoryl]amino]propanoate |
| SMILES | C#C[C@@]1(OCP(=O)(N[C@@H](C)C(=O)OCC)Oc2ccccc2)C=C[C@H](n2cnc3c(N)ncnc32)C1 |
| InChI | InChI=1S/C24H27N6O5P/c1-4-24(12-11-18(13-24)30-15-28-20-21(25)26-14-27-22(20)30)34-16-36(32,29-17(3)23(31)33-5-2)35-19-9-7-6-8-10-19/h1,6-12,14-15,17-18H,5,13,16H2,2-3H3,(H,29,32)(H2,25,26,27)/t17-,18-,24+,36?/m0/s1 |
| InChIKey | BZZRHWONWXLJMC-MTVDIVTLSA-N |
| XLogP | 3.07 |
| TPSA | 143.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 510.49 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|