C11H18N5O5P — CID 161448671
[(2R)-1-(6-aminopurin-9-yl)-5-tritiooxypentan-2-yl]oxymethylphosphonic acid (PubChem CID 161448671) has the molecular formula C11H18N5O5P and a molecular weight of 333.28 g/mol. Its IUPAC name is [(2R)-1-(6-aminopurin-9-yl)-5-tritiooxypentan-2-yl]oxymethylphosphonic acid.
| Compound Name | [(2R)-1-(6-aminopurin-9-yl)-5-tritiooxypentan-2-yl]oxymethylphosphonic acid |
|---|---|
| PubChem CID | 161448671 |
| Molecular Formula | C11H18N5O5P |
| Molecular Weight | 333.28 g/mol |
| Exact Mass | 333.11 |
| IUPAC Name | [(2R)-1-(6-aminopurin-9-yl)-5-tritiooxypentan-2-yl]oxymethylphosphonic acid |
| SMILES | [3H]OCCC[C@H](Cn1cnc2c(N)ncnc21)OCP(=O)(O)O |
| InChI | InChI=1S/C11H18N5O5P/c12-10-9-11(14-5-13-10)16(6-15-9)4-8(2-1-3-17)21-7-22(18,19)20/h5-6,8,17H,1-4,7H2,(H2,12,13,14)(H2,18,19,20)/t8-/m1/s1/i17T |
| InChIKey | WHLMYXXHYNIGPJ-GDRZMQQTSA-N |
| XLogP | -0.30 |
| TPSA | 156.61 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.28 |
| LogP ≤ 5 | -0.30 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|