C14H22N5O7P — CID 10363787
2-(6-aminopurin-9-yl)oxyethoxymethyl-(2,2-dimethylpropanoyloxymethoxy)phosphinic acid (PubChem CID 10363787) has the molecular formula C14H22N5O7P and a molecular weight of 403.33 g/mol. Its IUPAC name is 2-(6-aminopurin-9-yl)oxyethoxymethyl-(2,2-dimethylpropanoyloxymethoxy)phosphinic acid.
| Compound Name | 2-(6-aminopurin-9-yl)oxyethoxymethyl-(2,2-dimethylpropanoyloxymethoxy)phosphinic acid |
|---|---|
| PubChem CID | 10363787 |
| Molecular Formula | C14H22N5O7P |
| Molecular Weight | 403.33 g/mol |
| Exact Mass | 403.13 |
| IUPAC Name | 2-(6-aminopurin-9-yl)oxyethoxymethyl-(2,2-dimethylpropanoyloxymethoxy)phosphinic acid |
| SMILES | CC(C)(C)C(=O)OCOP(=O)(O)COCCOn1cnc2c(N)ncnc21 |
| InChI | InChI=1S/C14H22N5O7P/c1-14(2,3)13(20)24-8-26-27(21,22)9-23-4-5-25-19-7-18-10-11(15)16-6-17-12(10)19/h6-7H,4-5,8-9H2,1-3H3,(H,21,22)(H2,15,16,17) |
| InChIKey | XZTTVQLXQZPMOB-UHFFFAOYSA-N |
| XLogP | 0.56 |
| TPSA | 160.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.33 |
| LogP ≤ 5 | 0.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|