C9H12N5O4P — CID 6474323
[(E)-4-(6-aminopurin-9-yl)oxybut-1-enyl]phosphonic acid (PubChem CID 6474323) has the molecular formula C9H12N5O4P and a molecular weight of 285.20 g/mol. Its IUPAC name is [(E)-4-(6-aminopurin-9-yl)oxybut-1-enyl]phosphonic acid.
| Compound Name | [(E)-4-(6-aminopurin-9-yl)oxybut-1-enyl]phosphonic acid |
|---|---|
| PubChem CID | 6474323 |
| Molecular Formula | C9H12N5O4P |
| Molecular Weight | 285.20 g/mol |
| Exact Mass | 285.06 |
| IUPAC Name | [(E)-4-(6-aminopurin-9-yl)oxybut-1-enyl]phosphonic acid |
| SMILES | Nc1ncnc2c1ncn2OCC/C=C/P(=O)(O)O |
| InChI | InChI=1S/C9H12N5O4P/c10-8-7-9(12-5-11-8)14(6-13-7)18-3-1-2-4-19(15,16)17/h2,4-6H,1,3H2,(H2,10,11,12)(H2,15,16,17)/b4-2+ |
| InChIKey | NDUZBIYAVVGZQH-DUXPYHPUSA-N |
| XLogP | -0.08 |
| TPSA | 136.38 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.20 |
| LogP ≤ 5 | -0.08 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|